C20H41NS2 — CID 174338939
1-[1,3-dimethyl-1-(2,5,6-trimethyl-4-methylsulfanylhept-6-en-3-yl)thiiran-2-yl]-N,2-dimethylpropan-1-amine (PubChem CID 174338939) has the molecular formula C20H41NS2 and a molecular weight of 359.69 g/mol. Its IUPAC name is 1-[1,3-dimethyl-1-(2,5,6-trimethyl-4-methylsulfanylhept-6-en-3-yl)thiiran-2-yl]-N,2-dimethylpropan-1-amine.
| Compound Name | 1-[1,3-dimethyl-1-(2,5,6-trimethyl-4-methylsulfanylhept-6-en-3-yl)thiiran-2-yl]-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 174338939 |
| Molecular Formula | C20H41NS2 |
| Molecular Weight | 359.69 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | 1-[1,3-dimethyl-1-(2,5,6-trimethyl-4-methylsulfanylhept-6-en-3-yl)thiiran-2-yl]-N,2-dimethylpropan-1-amine |
| SMILES | C=C(C)C(C)C(SC)C(C(C)C)S1(C)C(C)C1C(NC)C(C)C |
| InChI | InChI=1S/C20H41NS2/c1-12(2)15(7)18(22-10)19(14(5)6)23(11)16(8)20(23)17(21-9)13(3)4/h13-21H,1H2,2-11H3 |
| InChIKey | JOZXGSYUBMALQG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|