[4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid

C28H20BNO2 — CID 174339452

IUPAC[4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid
SMILESOB(O)c1ccc(-c2ccc3c4c5ccccc5ccc4n(-c4ccccc4)c3c2)cc1
InChIInChI=1S/C28H20BNO2/c31-29(32)22-14-10-19(11-15-22)21-12-16-25-27(18-21)30(23-7-2-1-3-8-23)26-17-13-20-6-4-5-9-24(20)28(25)26/h1-18,31-32H
InChIKeyKJYJHCCCJQJKPB-UHFFFAOYSA-N
MW413.29 g/mol
LogP5.28
Rot. Bonds3

About [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid

[4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid (PubChem CID 174339452) has the molecular formula C28H20BNO2 and a molecular weight of 413.29 g/mol. Its IUPAC name is [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid.

Molecular Properties

Compound Name[4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid
PubChem CID174339452
Molecular FormulaC28H20BNO2
Molecular Weight413.29 g/mol
Exact Mass413.16
IUPAC Name[4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid
SMILESOB(O)c1ccc(-c2ccc3c4c5ccccc5ccc4n(-c4ccccc4)c3c2)cc1
InChIInChI=1S/C28H20BNO2/c31-29(32)22-14-10-19(11-15-22)21-12-16-25-27(18-21)30(23-7-2-1-3-8-23)26-17-13-20-6-4-5-9-24(20)28(25)26/h1-18,31-32H
InChIKeyKJYJHCCCJQJKPB-UHFFFAOYSA-N
XLogP5.28
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms32
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500413.29
LogP ≤ 55.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid?
The IUPAC name of [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid (CID 174339452) is [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid.
What is the SMILES notation for [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid?
The canonical SMILES for [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid is OB(O)c1ccc(-c2ccc3c4c5ccccc5ccc4n(-c4ccccc4)c3c2)cc1.
What is the InChIKey of [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid?
The InChIKey is KJYJHCCCJQJKPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20BNO2/c31-29(32)22-14-10-19(11-15-22)21-12-16-25-27(18-21)30(23-7-2-1-3-8-23)26-17-13-20-6-4-5-9-24(20)28(25)26/h1-18,31-32H.
What are the key properties of [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid?
[4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid has a molecular weight of 413.29 g/mol, XLogP of 5.28, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(7-phenylbenzo[g]carbazol-9-yl)phenyl]boronic acid is sourced from PubChem (CID 174339452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).