About (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate
(3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate (PubChem CID 174339473) has the molecular formula C24H23F2N3O4S
and a molecular weight of 487.53 g/mol. Its IUPAC name is (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate.
Molecular Properties
| Compound Name | (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate |
| PubChem CID | 174339473 |
| Molecular Formula | C24H23F2N3O4S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate |
| SMILES | CC(C)c1nc(CCO)n(Cc2cnc3ccccc3c2)c1S(=O)(=O)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H23F2N3O4S/c1-15(2)23-24(34(31,32)33-20-11-18(25)10-19(26)12-20)29(22(28-23)7-8-30)14-16-9-17-5-3-4-6-21(17)27-13-16/h3-6,9-13,15,30H,7-8,14H2,1-2H3 |
| InChIKey | APWZXIUQXHGNSX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate?
The IUPAC name of (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate (CID 174339473) is (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate.
What is the SMILES notation for (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate?
The canonical SMILES for (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate is CC(C)c1nc(CCO)n(Cc2cnc3ccccc3c2)c1S(=O)(=O)Oc1cc(F)cc(F)c1.
What is the InChIKey of (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate?
The InChIKey is APWZXIUQXHGNSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F2N3O4S/c1-15(2)23-24(34(31,32)33-20-11-18(25)10-19(26)12-20)29(22(28-23)7-8-30)14-16-9-17-5-3-4-6-21(17)27-13-16/h3-6,9-13,15,30H,7-8,14H2,1-2H3.
What are the key properties of (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate?
(3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate has a molecular weight of 487.53 g/mol, XLogP of 4.18, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl) 2-(2-hydroxyethyl)-5-propan-2-yl-3-(quinolin-3-ylmethyl)imidazole-4-sulfonate is sourced from PubChem (CID 174339473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).