About acridine;1-nitroguanidine
acridine;1-nitroguanidine (PubChem CID 174339962) has the molecular formula C14H13N5O2
and a molecular weight of 283.29 g/mol. Its IUPAC name is acridine;1-nitroguanidine.
Molecular Properties
| Compound Name | acridine;1-nitroguanidine |
| PubChem CID | 174339962 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | acridine;1-nitroguanidine |
| SMILES | [H]/N=C(\N)N[N+](=O)[O-].c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.CH4N4O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;2-1(3)4-5(6)7/h1-9H;(H4,2,3,4) |
| InChIKey | VNYCBXNZLPTUMD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acridine;1-nitroguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;1-nitroguanidine?
The IUPAC name of acridine;1-nitroguanidine (CID 174339962) is acridine;1-nitroguanidine.
What is the SMILES notation for acridine;1-nitroguanidine?
The canonical SMILES for acridine;1-nitroguanidine is [H]/N=C(\N)N[N+](=O)[O-].c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;1-nitroguanidine?
The InChIKey is VNYCBXNZLPTUMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.CH4N4O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;2-1(3)4-5(6)7/h1-9H;(H4,2,3,4).
What are the key properties of acridine;1-nitroguanidine?
acridine;1-nitroguanidine has a molecular weight of 283.29 g/mol, XLogP of 2.05, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;1-nitroguanidine is sourced from PubChem (CID 174339962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).