C27H38N4O3 — CID 174340386
(2S,4Z,6Z)-3-methylidene-2-[[[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidine-3-carbonyl]amino]methyl]octa-4,6-dienoic acid (PubChem CID 174340386) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is (2S,4Z,6Z)-3-methylidene-2-[[[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidine-3-carbonyl]amino]methyl]octa-4,6-dienoic acid.
| Compound Name | (2S,4Z,6Z)-3-methylidene-2-[[[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidine-3-carbonyl]amino]methyl]octa-4,6-dienoic acid |
|---|---|
| PubChem CID | 174340386 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (2S,4Z,6Z)-3-methylidene-2-[[[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidine-3-carbonyl]amino]methyl]octa-4,6-dienoic acid |
| SMILES | C=C(/C=C\C=C/C)[C@@H](CNC(=O)[C@@H]1CCCN(CCCc2ccc3c(n2)NCCC3)C1)C(=O)O |
| InChI | InChI=1S/C27H38N4O3/c1-3-4-5-9-20(2)24(27(33)34)18-29-26(32)22-11-7-16-31(19-22)17-8-12-23-14-13-21-10-6-15-28-25(21)30-23/h3-5,9,13-14,22,24H,2,6-8,10-12,15-19H2,1H3,(H,28,30)(H,29,32)(H,33,34)/b4-3-,9-5-/t22-,24-/m1/s1 |
| InChIKey | QNKJSMHHDXHDOY-WRANVFSRSA-N |
| XLogP | 3.59 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|