C11H23NO — CID 174340695
(E,7R)-8-amino-4,5,7-trimethyloct-5-en-2-ol (PubChem CID 174340695) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (E,7R)-8-amino-4,5,7-trimethyloct-5-en-2-ol.
| Compound Name | (E,7R)-8-amino-4,5,7-trimethyloct-5-en-2-ol |
|---|---|
| PubChem CID | 174340695 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (E,7R)-8-amino-4,5,7-trimethyloct-5-en-2-ol |
| SMILES | C/C(=C\[C@@H](C)CN)C(C)CC(C)O |
| InChI | InChI=1S/C11H23NO/c1-8(7-12)5-9(2)10(3)6-11(4)13/h5,8,10-11,13H,6-7,12H2,1-4H3/b9-5+/t8-,10?,11?/m1/s1 |
| InChIKey | NWQFGBSTOVGDNG-RGILLITESA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|