About 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate
2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate (PubChem CID 174340957) has the molecular formula C17H21Cl2N3O4S
and a molecular weight of 434.35 g/mol. Its IUPAC name is 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate |
| PubChem CID | 174340957 |
| Molecular Formula | C17H21Cl2N3O4S |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate |
| SMILES | CCn1c(CCOC(N)=O)nc(C(C)C)c1S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H21Cl2N3O4S/c1-4-22-14(5-6-26-17(20)23)21-15(10(2)3)16(22)27(24,25)13-8-11(18)7-12(19)9-13/h7-10H,4-6H2,1-3H3,(H2,20,23) |
| InChIKey | CXSXHTRBBJCFDR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate?
The IUPAC name of 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate (CID 174340957) is 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate.
What is the SMILES notation for 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate?
The canonical SMILES for 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate is CCn1c(CCOC(N)=O)nc(C(C)C)c1S(=O)(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate?
The InChIKey is CXSXHTRBBJCFDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21Cl2N3O4S/c1-4-22-14(5-6-26-17(20)23)21-15(10(2)3)16(22)27(24,25)13-8-11(18)7-12(19)9-13/h7-10H,4-6H2,1-3H3,(H2,20,23).
What are the key properties of 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate?
2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate has a molecular weight of 434.35 g/mol, XLogP of 3.80, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,5-dichlorophenyl)sulfonyl-1-ethyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate is sourced from PubChem (CID 174340957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).