C19H22Cl3NO — CID 174341311
5-[(2R)-1-chloro-2-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide (PubChem CID 174341311) has the molecular formula C19H22Cl3NO and a molecular weight of 386.75 g/mol. Its IUPAC name is 5-[(2R)-1-chloro-2-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide.
| Compound Name | 5-[(2R)-1-chloro-2-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 174341311 |
| Molecular Formula | C19H22Cl3NO |
| Molecular Weight | 386.75 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 5-[(2R)-1-chloro-2-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
| SMILES | CC(C)C(C)NC(=O)C=CC=CC1(Cl)C[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl3NO/c1-12(2)13(3)23-18(24)6-4-5-9-19(22)11-15(19)14-7-8-16(20)17(21)10-14/h4-10,12-13,15H,11H2,1-3H3,(H,23,24)/t13?,15-,19?/m1/s1 |
| InChIKey | TWUCDFRAUOSWAC-SHBDPFAUSA-N |
| XLogP | 5.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.75 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|