About 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole
5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole (PubChem CID 174341454) has the molecular formula C20H20N2O
and a molecular weight of 304.39 g/mol. Its IUPAC name is 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole.
Molecular Properties
| Compound Name | 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole |
| PubChem CID | 174341454 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole |
| SMILES | CCCOc1nccc2c(C)c3[nH]c4ccccc4c3c(C)c12 |
| InChI | InChI=1S/C20H20N2O/c1-4-11-23-20-18-13(3)17-15-7-5-6-8-16(15)22-19(17)12(2)14(18)9-10-21-20/h5-10,22H,4,11H2,1-3H3 |
| InChIKey | WFRDWYLFMABPIO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole?
The IUPAC name of 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole (CID 174341454) is 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole.
What is the SMILES notation for 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole?
The canonical SMILES for 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole is CCCOc1nccc2c(C)c3[nH]c4ccccc4c3c(C)c12.
What is the InChIKey of 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole?
The InChIKey is WFRDWYLFMABPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O/c1-4-11-23-20-18-13(3)17-15-7-5-6-8-16(15)22-19(17)12(2)14(18)9-10-21-20/h5-10,22H,4,11H2,1-3H3.
What are the key properties of 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole?
5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole has a molecular weight of 304.39 g/mol, XLogP of 5.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,11-dimethyl-1-propoxy-6H-pyrido[4,3-b]carbazole is sourced from PubChem (CID 174341454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).