C15H24N2 — CID 174341674
(2E,6Z)-5,8-dimethyl-6-(3-methylpent-4-en-2-yl)-4,5-dihydroazocin-7-amine (PubChem CID 174341674) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (2E,6Z)-5,8-dimethyl-6-(3-methylpent-4-en-2-yl)-4,5-dihydroazocin-7-amine.
| Compound Name | (2E,6Z)-5,8-dimethyl-6-(3-methylpent-4-en-2-yl)-4,5-dihydroazocin-7-amine |
|---|---|
| PubChem CID | 174341674 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (2E,6Z)-5,8-dimethyl-6-(3-methylpent-4-en-2-yl)-4,5-dihydroazocin-7-amine |
| SMILES | C=CC(C)C(C)/C1=C(N)/C(C)=N\C=C/CC1C |
| InChI | InChI=1S/C15H24N2/c1-6-10(2)12(4)14-11(3)8-7-9-17-13(5)15(14)16/h6-7,9-12H,1,8,16H2,2-5H3/b9-7-,15-14-,17-13- |
| InChIKey | UHQFAPBXKGKMSV-SNQLNIGUSA-N |
| XLogP | 3.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|