About 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal
5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal (PubChem CID 174341871) has the molecular formula C17H30N2O
and a molecular weight of 278.44 g/mol. Its IUPAC name is 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal.
Molecular Properties
| Compound Name | 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal |
| PubChem CID | 174341871 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal |
| SMILES | C=CC(C)(C=CCC=O)NCCC(=CC)N(C)CCC |
| InChI | InChI=1S/C17H30N2O/c1-6-14-19(5)16(7-2)11-13-18-17(4,8-3)12-9-10-15-20/h7-9,12,15,18H,3,6,10-11,13-14H2,1-2,4-5H3 |
| InChIKey | XWRDKWIWGLSTHR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal?
The IUPAC name of 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal (CID 174341871) is 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal.
What is the SMILES notation for 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal?
The canonical SMILES for 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal is C=CC(C)(C=CCC=O)NCCC(=CC)N(C)CCC.
What is the InChIKey of 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal?
The InChIKey is XWRDKWIWGLSTHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O/c1-6-14-19(5)16(7-2)11-13-18-17(4,8-3)12-9-10-15-20/h7-9,12,15,18H,3,6,10-11,13-14H2,1-2,4-5H3.
What are the key properties of 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal?
5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal has a molecular weight of 278.44 g/mol, XLogP of 3.30, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-[3-[methyl(propyl)amino]pent-3-enylamino]hepta-3,6-dienal is sourced from PubChem (CID 174341871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).