About 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine
2-fluoro-4-(4-methylphenyl)-1,3,5-triazine (PubChem CID 174341953) has the molecular formula C10H8FN3
and a molecular weight of 189.19 g/mol. Its IUPAC name is 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine |
| PubChem CID | 174341953 |
| Molecular Formula | C10H8FN3 |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2ncnc(F)n2)cc1 |
| InChI | InChI=1S/C10H8FN3/c1-7-2-4-8(5-3-7)9-12-6-13-10(11)14-9/h2-6H,1H3 |
| InChIKey | VRCNMZKKXOBKRW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine?
The IUPAC name of 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine (CID 174341953) is 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine.
What is the SMILES notation for 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine?
The canonical SMILES for 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine is Cc1ccc(-c2ncnc(F)n2)cc1.
What is the InChIKey of 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine?
The InChIKey is VRCNMZKKXOBKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FN3/c1-7-2-4-8(5-3-7)9-12-6-13-10(11)14-9/h2-6H,1H3.
What are the key properties of 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine?
2-fluoro-4-(4-methylphenyl)-1,3,5-triazine has a molecular weight of 189.19 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(4-methylphenyl)-1,3,5-triazine is sourced from PubChem (CID 174341953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).