About 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine
1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine (PubChem CID 174341983) has the molecular formula C11H21N5O2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine.
Molecular Properties
| Compound Name | 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine |
| PubChem CID | 174341983 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine |
| SMILES | CC1CC2CC2(C)C1.NC1=NN([N+](=O)[O-])NCC1 |
| InChI | InChI=1S/C8H14.C3H7N5O2/c1-6-3-7-5-8(7,2)4-6;4-3-1-2-5-7(6-3)8(9)10/h6-7H,3-5H2,1-2H3;5H,1-2H2,(H2,4,6) |
| InChIKey | QXTFUIMEMOWTBB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine?
The IUPAC name of 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine (CID 174341983) is 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine.
What is the SMILES notation for 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine?
The canonical SMILES for 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine is CC1CC2CC2(C)C1.NC1=NN([N+](=O)[O-])NCC1.
What is the InChIKey of 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine?
The InChIKey is QXTFUIMEMOWTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.C3H7N5O2/c1-6-3-7-5-8(7,2)4-6;4-3-1-2-5-7(6-3)8(9)10/h6-7H,3-5H2,1-2H3;5H,1-2H2,(H2,4,6).
What are the key properties of 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine?
1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine has a molecular weight of 255.32 g/mol, XLogP of 1.10, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylbicyclo[3.1.0]hexane;2-nitro-5,6-dihydro-1H-triazin-4-amine is sourced from PubChem (CID 174341983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).