C7H7F3N4 — CID 174342040
(3Z)-4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]buta-1,3-dien-2-amine (PubChem CID 174342040) has the molecular formula C7H7F3N4 and a molecular weight of 204.16 g/mol. Its IUPAC name is (3Z)-4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]buta-1,3-dien-2-amine.
| Compound Name | (3Z)-4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 174342040 |
| Molecular Formula | C7H7F3N4 |
| Molecular Weight | 204.16 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (3Z)-4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]buta-1,3-dien-2-amine |
| SMILES | C=C(N)/C=C\c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H7F3N4/c1-4(11)2-3-5-12-6(14-13-5)7(8,9)10/h2-3H,1,11H2,(H,12,13,14)/b3-2- |
| InChIKey | QIQNISOEZMRQIY-IHWYPQMZSA-N |
| XLogP | 1.31 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|