C9H18O8 — CID 174342158
6-ethylcycloheptane-1,1,2,2,3,3,4,4-octol (PubChem CID 174342158) has the molecular formula C9H18O8 and a molecular weight of 254.23 g/mol. Its IUPAC name is 6-ethylcycloheptane-1,1,2,2,3,3,4,4-octol.
| Compound Name | 6-ethylcycloheptane-1,1,2,2,3,3,4,4-octol |
|---|---|
| PubChem CID | 174342158 |
| Molecular Formula | C9H18O8 |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 6-ethylcycloheptane-1,1,2,2,3,3,4,4-octol |
| SMILES | CCC1CC(O)(O)C(O)(O)C(O)(O)C(O)(O)C1 |
| InChI | InChI=1S/C9H18O8/c1-2-5-3-6(10,11)8(14,15)9(16,17)7(12,13)4-5/h5,10-17H,2-4H2,1H3 |
| InChIKey | GRKSVLPOJSWSRT-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|