About bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile
bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile (PubChem CID 174342528) has the molecular formula C12H12BrNO2
and a molecular weight of 282.14 g/mol. Its IUPAC name is bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile.
Molecular Properties
| Compound Name | bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile |
| PubChem CID | 174342528 |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile |
| SMILES | Brc1ccccc1.CC(=O)C(C#N)CC=O |
| InChI | InChI=1S/C6H5Br.C6H7NO2/c7-6-4-2-1-3-5-6;1-5(9)6(4-7)2-3-8/h1-5H;3,6H,2H2,1H3 |
| InChIKey | FCRNOVSDTVNKKM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile?
The IUPAC name of bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile (CID 174342528) is bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile.
What is the SMILES notation for bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile?
The canonical SMILES for bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile is Brc1ccccc1.CC(=O)C(C#N)CC=O.
What is the InChIKey of bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile?
The InChIKey is FCRNOVSDTVNKKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br.C6H7NO2/c7-6-4-2-1-3-5-6;1-5(9)6(4-7)2-3-8/h1-5H;3,6H,2H2,1H3.
What are the key properties of bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile?
bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile has a molecular weight of 282.14 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;3-oxo-2-(2-oxoethyl)butanenitrile is sourced from PubChem (CID 174342528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).