C12H24N2O2 — CID 174342776
N,N',2-trimethyl-N,N'-di(propan-2-yl)propanediamide (PubChem CID 174342776) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N,N',2-trimethyl-N,N'-di(propan-2-yl)propanediamide.
| Compound Name | N,N',2-trimethyl-N,N'-di(propan-2-yl)propanediamide |
|---|---|
| PubChem CID | 174342776 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N,N',2-trimethyl-N,N'-di(propan-2-yl)propanediamide |
| SMILES | CC(C(=O)N(C)C(C)C)C(=O)N(C)C(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-8(2)13(6)11(15)10(5)12(16)14(7)9(3)4/h8-10H,1-7H3 |
| InChIKey | CTKYAUZCRLOXCM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|