C51H32N4O12 — CID 174343726
9-[4-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]-6-(2,3,4,5-tetrahydroxyphenyl)carbazole-1,2,3,4,5,7,8-heptol (PubChem CID 174343726) has the molecular formula C51H32N4O12 and a molecular weight of 892.83 g/mol. Its IUPAC name is 9-[4-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]-6-(2,3,4,5-tetrahydroxyphenyl)carbazole-1,2,3,4,5,7,8-heptol.
| Compound Name | 9-[4-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]-6-(2,3,4,5-tetrahydroxyphenyl)carbazole-1,2,3,4,5,7,8-heptol |
|---|---|
| PubChem CID | 174343726 |
| Molecular Formula | C51H32N4O12 |
| Molecular Weight | 892.83 g/mol |
| Exact Mass | 892.20 |
| IUPAC Name | 9-[4-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]-6-(2,3,4,5-tetrahydroxyphenyl)carbazole-1,2,3,4,5,7,8-heptol |
| SMILES | Oc1cc(-c2c(O)c(O)c3c(c2O)c2c(O)c(O)c(O)c(O)c2n3-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc5c4oc4ccccc45)n3)cc2-c2ccccc2)c(O)c(O)c1O |
| InChI | InChI=1S/C51H32N4O12/c56-31-21-29(38(57)45(64)39(31)58)33-40(59)34-35-37(44(63)47(66)46(65)42(35)61)55(36(34)43(62)41(33)60)30-19-18-24(20-28(30)22-10-3-1-4-11-22)50-52-49(23-12-5-2-6-13-23)53-51(54-50)27-16-9-15-26-25-14-7-8-17-32(25)67-48(26)27/h1-21,56-66H |
| InChIKey | DXNHSMJOHKKSBD-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 279.27 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.83 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|