C27H41BrN4O4S — CID 174343825
8-bromo-7-methoxy-2-pentyl-3,4-dihydro-1H-isoquinoline;4-methoxy-3-(4-methylpiperazin-1-yl)benzenesulfonamide (PubChem CID 174343825) has the molecular formula C27H41BrN4O4S and a molecular weight of 597.62 g/mol. Its IUPAC name is 8-bromo-7-methoxy-2-pentyl-3,4-dihydro-1H-isoquinoline;4-methoxy-3-(4-methylpiperazin-1-yl)benzenesulfonamide.
| Compound Name | 8-bromo-7-methoxy-2-pentyl-3,4-dihydro-1H-isoquinoline;4-methoxy-3-(4-methylpiperazin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 174343825 |
| Molecular Formula | C27H41BrN4O4S |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | 8-bromo-7-methoxy-2-pentyl-3,4-dihydro-1H-isoquinoline;4-methoxy-3-(4-methylpiperazin-1-yl)benzenesulfonamide |
| SMILES | CCCCCN1CCc2ccc(OC)c(Br)c2C1.COc1ccc(S(N)(=O)=O)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C15H22BrNO.C12H19N3O3S/c1-3-4-5-9-17-10-8-12-6-7-14(18-2)15(16)13(12)11-17;1-14-5-7-15(8-6-14)11-9-10(19(13,16)17)3-4-12(11)18-2/h6-7H,3-5,8-11H2,1-2H3;3-4,9H,5-8H2,1-2H3,(H2,13,16,17) |
| InChIKey | HKWDCTZIBKJQBD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|