About 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene
1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene (PubChem CID 174343933) has the molecular formula C14H15F
and a molecular weight of 202.27 g/mol. Its IUPAC name is 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene |
| PubChem CID | 174343933 |
| Molecular Formula | C14H15F |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene |
| SMILES | C#CC(=C)C(C)(F)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H15F/c1-6-12(4)14(5,15)13-8-10(2)7-11(3)9-13/h1,7-9H,4H2,2-3,5H3 |
| InChIKey | CKSPKISNGIZBKY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene?
The IUPAC name of 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene (CID 174343933) is 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene.
What is the SMILES notation for 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene?
The canonical SMILES for 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene is C#CC(=C)C(C)(F)c1cc(C)cc(C)c1.
What is the InChIKey of 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene?
The InChIKey is CKSPKISNGIZBKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F/c1-6-12(4)14(5,15)13-8-10(2)7-11(3)9-13/h1,7-9H,4H2,2-3,5H3.
What are the key properties of 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene?
1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene has a molecular weight of 202.27 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoro-3-methylidenepent-4-yn-2-yl)-3,5-dimethylbenzene is sourced from PubChem (CID 174343933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).