About 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid
4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid (PubChem CID 174343996) has the molecular formula C11H9NO4
and a molecular weight of 219.20 g/mol. Its IUPAC name is 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid |
| PubChem CID | 174343996 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid |
| SMILES | O=CC1(c2ccc(C(=O)O)cc2)N=CCO1 |
| InChI | InChI=1S/C11H9NO4/c13-7-11(12-5-6-16-11)9-3-1-8(2-4-9)10(14)15/h1-5,7H,6H2,(H,14,15) |
| InChIKey | MBDKUOXNABPALE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid?
The IUPAC name of 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid (CID 174343996) is 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid.
What is the SMILES notation for 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid?
The canonical SMILES for 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid is O=CC1(c2ccc(C(=O)O)cc2)N=CCO1.
What is the InChIKey of 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid?
The InChIKey is MBDKUOXNABPALE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c13-7-11(12-5-6-16-11)9-3-1-8(2-4-9)10(14)15/h1-5,7H,6H2,(H,14,15).
What are the key properties of 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid?
4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid has a molecular weight of 219.20 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-formyl-5H-1,3-oxazol-2-yl)benzoic acid is sourced from PubChem (CID 174343996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).