C35H48N4O4S — CID 174344406
methyl N-[[5-[[[C-butyl-N-(1-formylcyclopentyl)carbonimidoyl]-methylamino]methyl]-2-[2-[[(3Z)-4-methoxy-3-methylpenta-1,3-dien-2-yl]amino]sulfanylphenyl]phenyl]methyl]carbamate (PubChem CID 174344406) has the molecular formula C35H48N4O4S and a molecular weight of 620.86 g/mol. Its IUPAC name is methyl N-[[5-[[[C-butyl-N-(1-formylcyclopentyl)carbonimidoyl]-methylamino]methyl]-2-[2-[[(3Z)-4-methoxy-3-methylpenta-1,3-dien-2-yl]amino]sulfanylphenyl]phenyl]methyl]carbamate.
| Compound Name | methyl N-[[5-[[[C-butyl-N-(1-formylcyclopentyl)carbonimidoyl]-methylamino]methyl]-2-[2-[[(3Z)-4-methoxy-3-methylpenta-1,3-dien-2-yl]amino]sulfanylphenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 174344406 |
| Molecular Formula | C35H48N4O4S |
| Molecular Weight | 620.86 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | methyl N-[[5-[[[C-butyl-N-(1-formylcyclopentyl)carbonimidoyl]-methylamino]methyl]-2-[2-[[(3Z)-4-methoxy-3-methylpenta-1,3-dien-2-yl]amino]sulfanylphenyl]phenyl]methyl]carbamate |
| SMILES | C=C(NSc1ccccc1-c1ccc(CN(C)/C(CCCC)=N/C2(C=O)CCCC2)cc1CNC(=O)OC)/C(C)=C(/C)OC |
| InChI | InChI=1S/C35H48N4O4S/c1-8-9-16-33(37-35(24-40)19-12-13-20-35)39(5)23-28-17-18-30(29(21-28)22-36-34(41)43-7)31-14-10-11-15-32(31)44-38-26(3)25(2)27(4)42-6/h10-11,14-15,17-18,21,24,38H,3,8-9,12-13,16,19-20,22-23H2,1-2,4-7H3,(H,36,41)/b27-25-,37-33+ |
| InChIKey | HTXKCAGYQRFHPA-PHKZDCJUSA-N |
| XLogP | 7.79 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.86 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|