About (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane
(3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane (PubChem CID 174344556) has the molecular formula C10H17NO6S2
and a molecular weight of 311.38 g/mol. Its IUPAC name is (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane.
Molecular Properties
| Compound Name | (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane |
| PubChem CID | 174344556 |
| Molecular Formula | C10H17NO6S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane |
| SMILES | CCS(=O)(=O)CC.Nc1cccc(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C6H7NO4S.C4H10O2S/c7-5-2-1-3-6(4-5)11-12(8,9)10;1-3-7(5,6)4-2/h1-4H,7H2,(H,8,9,10);3-4H2,1-2H3 |
| InChIKey | IPFSVUCBIOGREC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane?
The IUPAC name of (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane (CID 174344556) is (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane.
What is the SMILES notation for (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane?
The canonical SMILES for (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane is CCS(=O)(=O)CC.Nc1cccc(OS(=O)(=O)O)c1.
What is the InChIKey of (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane?
The InChIKey is IPFSVUCBIOGREC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO4S.C4H10O2S/c7-5-2-1-3-6(4-5)11-12(8,9)10;1-3-7(5,6)4-2/h1-4H,7H2,(H,8,9,10);3-4H2,1-2H3.
What are the key properties of (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane?
(3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane has a molecular weight of 311.38 g/mol, XLogP of 0.89, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminophenyl) hydrogen sulfate;1-ethylsulfonylethane is sourced from PubChem (CID 174344556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).