About 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide
4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide (PubChem CID 174344858) has the molecular formula C11H11N3O3
and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide.
Molecular Properties
| Compound Name | 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide |
| PubChem CID | 174344858 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide |
| SMILES | NNC(=O)c1ccc(C2(C=O)N=CCO2)cc1 |
| InChI | InChI=1S/C11H11N3O3/c12-14-10(16)8-1-3-9(4-2-8)11(7-15)13-5-6-17-11/h1-5,7H,6,12H2,(H,14,16) |
| InChIKey | UIBPFUVVRXDIMD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide?
The IUPAC name of 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide (CID 174344858) is 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide.
What is the SMILES notation for 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide?
The canonical SMILES for 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide is NNC(=O)c1ccc(C2(C=O)N=CCO2)cc1.
What is the InChIKey of 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide?
The InChIKey is UIBPFUVVRXDIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3/c12-14-10(16)8-1-3-9(4-2-8)11(7-15)13-5-6-17-11/h1-5,7H,6,12H2,(H,14,16).
What are the key properties of 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide?
4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide has a molecular weight of 233.23 g/mol, XLogP of -0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-formyl-5H-1,3-oxazol-2-yl)benzohydrazide is sourced from PubChem (CID 174344858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).