C29H27BrO6 — CID 174345106
methyl 6-bromo-1,2,3,4-tetrahydrochrysene-1-carboxylate;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174345106) has the molecular formula C29H27BrO6 and a molecular weight of 551.43 g/mol. Its IUPAC name is methyl 6-bromo-1,2,3,4-tetrahydrochrysene-1-carboxylate;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | methyl 6-bromo-1,2,3,4-tetrahydrochrysene-1-carboxylate;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174345106 |
| Molecular Formula | C29H27BrO6 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | methyl 6-bromo-1,2,3,4-tetrahydrochrysene-1-carboxylate;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.COC(=O)C1CCCc2c1ccc1c2cc(Br)c2ccccc21 |
| InChI | InChI=1S/C20H17BrO2.C9H10O4/c1-23-20(22)17-8-4-7-13-14(17)9-10-15-12-5-2-3-6-16(12)19(21)11-18(13)15;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h2-3,5-6,9-11,17H,4,7-8H2,1H3;2-4H,5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | OPBYKCVQOSLJMG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|