About ethene;silinane;styrene
ethene;silinane;styrene (PubChem CID 174345237) has the molecular formula C15H24Si
and a molecular weight of 232.44 g/mol. Its IUPAC name is ethene;silinane;styrene.
Molecular Properties
| Compound Name | ethene;silinane;styrene |
| PubChem CID | 174345237 |
| Molecular Formula | C15H24Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | ethene;silinane;styrene |
| SMILES | C1CC[SiH2]CC1.C=C.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C5H12Si.C2H4/c1-2-8-6-4-3-5-7-8;1-2-4-6-5-3-1;1-2/h2-7H,1H2;1-6H2;1-2H2 |
| InChIKey | KQADOYNATOZFHX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;silinane;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;silinane;styrene?
The IUPAC name of ethene;silinane;styrene (CID 174345237) is ethene;silinane;styrene.
What is the SMILES notation for ethene;silinane;styrene?
The canonical SMILES for ethene;silinane;styrene is C1CC[SiH2]CC1.C=C.C=Cc1ccccc1.
What is the InChIKey of ethene;silinane;styrene?
The InChIKey is KQADOYNATOZFHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C5H12Si.C2H4/c1-2-8-6-4-3-5-7-8;1-2-4-6-5-3-1;1-2/h2-7H,1H2;1-6H2;1-2H2.
What are the key properties of ethene;silinane;styrene?
ethene;silinane;styrene has a molecular weight of 232.44 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;silinane;styrene is sourced from PubChem (CID 174345237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).