C41H52BF2N7O11 — CID 174345608
CID 174345608 (PubChem CID 174345608) has the molecular formula C41H52BF2N7O11 and a molecular weight of 867.71 g/mol.
| Compound Name | CID 174345608 |
|---|---|
| PubChem CID | 174345608 |
| Molecular Formula | C41H52BF2N7O11 |
| Molecular Weight | 867.71 g/mol |
| Exact Mass | 867.38 |
| IUPAC Name | — |
| SMILES | [B]NCCOCCCOCCC(=O)NCc1cccc2c1CN(C(=O)C[C@@H]1C[C@@H](C(=O)NCC(=O)N3CC(F)(F)CC3C(=O)C(=O)NCc3ccc(OC)c(OC)c3)NC1=O)C2 |
| InChI | InChI=1S/C41H52BF2N7O11/c1-59-32-8-7-25(15-33(32)60-2)19-46-40(58)37(55)31-18-41(43,44)24-51(31)36(54)21-47-39(57)30-16-28(38(56)49-30)17-35(53)50-22-27-6-3-5-26(29(27)23-50)20-45-34(52)9-13-61-11-4-12-62-14-10-48-42/h3,5-8,15,28,30-31,48H,4,9-14,16-24H2,1-2H3,(H,45,52)(H,46,58)(H,47,57)(H,49,56)/t28-,30-,31?/m0/s1 |
| InChIKey | WDCCESVYRYTYFF-GRMXABTLSA-N |
| XLogP | -0.22 |
| TPSA | 223.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.71 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|