About 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine
8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 174345641) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
| PubChem CID | 174345641 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CCc1cc(C(C)C)cn2ncnc12 |
| InChI | InChI=1S/C11H15N3/c1-4-9-5-10(8(2)3)6-14-11(9)12-7-13-14/h5-8H,4H2,1-3H3 |
| InChIKey | KWSRLKGNWKDCKD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine (CID 174345641) is 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine is CCc1cc(C(C)C)cn2ncnc12.
What is the InChIKey of 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is KWSRLKGNWKDCKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-4-9-5-10(8(2)3)6-14-11(9)12-7-13-14/h5-8H,4H2,1-3H3.
What are the key properties of 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine?
8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 189.26 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 174345641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).