C10H18N2 — CID 174345655
3-(cyclobutylmethyl)-4-methyl-1,2,3,6-tetrahydropyridazine (PubChem CID 174345655) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-4-methyl-1,2,3,6-tetrahydropyridazine.
| Compound Name | 3-(cyclobutylmethyl)-4-methyl-1,2,3,6-tetrahydropyridazine |
|---|---|
| PubChem CID | 174345655 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-(cyclobutylmethyl)-4-methyl-1,2,3,6-tetrahydropyridazine |
| SMILES | CC1=CCNNC1CC1CCC1 |
| InChI | InChI=1S/C10H18N2/c1-8-5-6-11-12-10(8)7-9-3-2-4-9/h5,9-12H,2-4,6-7H2,1H3 |
| InChIKey | PIUQTXFCAVAEIF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|