C26H47N — CID 174346137
(Z,3R)-3-(cyclohexylmethyl)-N,8-dimethyl-4-[(Z)-2-methylbut-1-enyl]-5-propylnon-4-en-2-imine (PubChem CID 174346137) has the molecular formula C26H47N and a molecular weight of 373.67 g/mol. Its IUPAC name is (Z,3R)-3-(cyclohexylmethyl)-N,8-dimethyl-4-[(Z)-2-methylbut-1-enyl]-5-propylnon-4-en-2-imine.
| Compound Name | (Z,3R)-3-(cyclohexylmethyl)-N,8-dimethyl-4-[(Z)-2-methylbut-1-enyl]-5-propylnon-4-en-2-imine |
|---|---|
| PubChem CID | 174346137 |
| Molecular Formula | C26H47N |
| Molecular Weight | 373.67 g/mol |
| Exact Mass | 373.37 |
| IUPAC Name | (Z,3R)-3-(cyclohexylmethyl)-N,8-dimethyl-4-[(Z)-2-methylbut-1-enyl]-5-propylnon-4-en-2-imine |
| SMILES | CCC/C(CCC(C)C)=C(\C=C(\C)CC)[C@@H](CC1CCCCC1)/C(C)=N/C |
| InChI | InChI=1S/C26H47N/c1-8-13-24(17-16-20(3)4)26(18-21(5)9-2)25(22(6)27-7)19-23-14-11-10-12-15-23/h18,20,23,25H,8-17,19H2,1-7H3/b21-18-,26-24-,27-22+/t25-/m0/s1 |
| InChIKey | OIQJFGDRYOCTNF-VNEJJLQFSA-N |
| XLogP | 8.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.67 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|