C25H22AsN5O5 — CID 174346290
(2-acetamido-6-hydroxyphenyl)arsonic acid;N-quinolin-6-ylquinazolin-4-amine (PubChem CID 174346290) has the molecular formula C25H22AsN5O5 and a molecular weight of 547.40 g/mol. Its IUPAC name is (2-acetamido-6-hydroxyphenyl)arsonic acid;N-quinolin-6-ylquinazolin-4-amine.
| Compound Name | (2-acetamido-6-hydroxyphenyl)arsonic acid;N-quinolin-6-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 174346290 |
| Molecular Formula | C25H22AsN5O5 |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | (2-acetamido-6-hydroxyphenyl)arsonic acid;N-quinolin-6-ylquinazolin-4-amine |
| SMILES | CC(=O)Nc1cccc(O)c1[As](=O)(O)O.c1cnc2ccc(Nc3ncnc4ccccc34)cc2c1 |
| InChI | InChI=1S/C17H12N4.C8H10AsNO5/c1-2-6-16-14(5-1)17(20-11-19-16)21-13-7-8-15-12(10-13)4-3-9-18-15;1-5(11)10-6-3-2-4-7(12)8(6)9(13,14)15/h1-11H,(H,19,20,21);2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | WMUYEIMQSWXEAB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|