C36H45N3O7 — CID 174346545
[(3S,4S,6S)-6-[(3S,4R,6R)-5-azido-4-methyl-6-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl]oxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methanol (PubChem CID 174346545) has the molecular formula C36H45N3O7 and a molecular weight of 631.77 g/mol. Its IUPAC name is [(3S,4S,6S)-6-[(3S,4R,6R)-5-azido-4-methyl-6-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl]oxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methanol.
| Compound Name | [(3S,4S,6S)-6-[(3S,4R,6R)-5-azido-4-methyl-6-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl]oxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 174346545 |
| Molecular Formula | C36H45N3O7 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | [(3S,4S,6S)-6-[(3S,4R,6R)-5-azido-4-methyl-6-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl]oxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methanol |
| SMILES | C[C@@H]1C(CO)O[C@@H](O[C@@H]2C(COCc3ccccc3)O[C@@H](OCc3ccccc3)C(N=[N+]=[N-])[C@H]2C)C(OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C36H45N3O7/c1-24-25(2)34(42-21-28-15-9-5-10-16-28)36(44-30(24)19-40)46-33-26(3)32(38-39-37)35(43-22-29-17-11-6-12-18-29)45-31(33)23-41-20-27-13-7-4-8-14-27/h4-18,24-26,30-36,40H,19-23H2,1-3H3/t24-,25-,26+,30?,31?,32?,33-,34?,35+,36-/m0/s1 |
| InChIKey | OEBWPMIEJFLARD-VHPURZRASA-N |
| XLogP | 6.42 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|