About 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate
3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate (PubChem CID 174346646) has the molecular formula C15H28O3S2
and a molecular weight of 320.52 g/mol. Its IUPAC name is 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate.
Molecular Properties
| Compound Name | 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate |
| PubChem CID | 174346646 |
| Molecular Formula | C15H28O3S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate |
| SMILES | CC1CC(CCSCCCOC(=O)CCCS)CCO1 |
| InChI | InChI=1S/C15H28O3S2/c1-13-12-14(5-8-17-13)6-11-20-10-3-7-18-15(16)4-2-9-19/h13-14,19H,2-12H2,1H3 |
| InChIKey | KXKXDQAQQKCVRL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate?
The IUPAC name of 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate (CID 174346646) is 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate.
What is the SMILES notation for 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate?
The canonical SMILES for 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate is CC1CC(CCSCCCOC(=O)CCCS)CCO1.
What is the InChIKey of 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate?
The InChIKey is KXKXDQAQQKCVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3S2/c1-13-12-14(5-8-17-13)6-11-20-10-3-7-18-15(16)4-2-9-19/h13-14,19H,2-12H2,1H3.
What are the key properties of 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate?
3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate has a molecular weight of 320.52 g/mol, XLogP of 3.57, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-methyloxan-4-yl)ethylsulfanyl]propyl 4-sulfanylbutanoate is sourced from PubChem (CID 174346646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).