About CID 174346651
CID 174346651 (PubChem CID 174346651) has the molecular formula C35H45B2N5O5S2
and a molecular weight of 701.53 g/mol.
Molecular Properties
| Compound Name | CID 174346651 |
| PubChem CID | 174346651 |
| Molecular Formula | C35H45B2N5O5S2 |
| Molecular Weight | 701.53 g/mol |
| Exact Mass | 701.30 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1ccc(-c2ccccc2S(=O)(=O)Nc2noc(C)c2C)c(COCC)c1)N(C)/C(CCCC)=N/C(C)=C(\C=O)CC(=S)N(C)C |
| InChI | InChI=1S/C35H45B2N5O5S2/c1-9-11-16-32(38-24(4)26(21-43)20-33(48)41(6)7)42(8)35(36,37)28-17-18-29(27(19-28)22-46-10-2)30-14-12-13-15-31(30)49(44,45)40-34-23(3)25(5)47-39-34/h12-15,17-19,21H,9-11,16,20,22H2,1-8H3,(H,39,40)/b26-24-,38-32+ |
| InChIKey | CUQHOBDYSRDLHL-OPLBMVCMSA-N |
| XLogP | 6.02 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 701.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 174346651 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174346651?
The IUPAC name of CID 174346651 (CID 174346651) is not available.
What is the SMILES notation for CID 174346651?
The canonical SMILES for CID 174346651 is [B]C([B])(c1ccc(-c2ccccc2S(=O)(=O)Nc2noc(C)c2C)c(COCC)c1)N(C)/C(CCCC)=N/C(C)=C(\C=O)CC(=S)N(C)C.
What is the InChIKey of CID 174346651?
The InChIKey is CUQHOBDYSRDLHL-OPLBMVCMSA-N. The full InChI is InChI=1S/C35H45B2N5O5S2/c1-9-11-16-32(38-24(4)26(21-43)20-33(48)41(6)7)42(8)35(36,37)28-17-18-29(27(19-28)22-46-10-2)30-14-12-13-15-31(30)49(44,45)40-34-23(3)25(5)47-39-34/h12-15,17-19,21H,9-11,16,20,22H2,1-8H3,(H,39,40)/b26-24-,38-32+.
What are the key properties of CID 174346651?
CID 174346651 has a molecular weight of 701.53 g/mol, XLogP of 6.02, 16 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174346651 is sourced from PubChem (CID 174346651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).