About oxolane;3-phenyl-1,2-oxazole
oxolane;3-phenyl-1,2-oxazole (PubChem CID 174347006) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is oxolane;3-phenyl-1,2-oxazole.
Molecular Properties
| Compound Name | oxolane;3-phenyl-1,2-oxazole |
| PubChem CID | 174347006 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | oxolane;3-phenyl-1,2-oxazole |
| SMILES | C1CCOC1.c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C9H7NO.C4H8O/c1-2-4-8(5-3-1)9-6-7-11-10-9;1-2-4-5-3-1/h1-7H;1-4H2 |
| InChIKey | ZBFZWCWEDCHPPD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxolane;3-phenyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;3-phenyl-1,2-oxazole?
The IUPAC name of oxolane;3-phenyl-1,2-oxazole (CID 174347006) is oxolane;3-phenyl-1,2-oxazole.
What is the SMILES notation for oxolane;3-phenyl-1,2-oxazole?
The canonical SMILES for oxolane;3-phenyl-1,2-oxazole is C1CCOC1.c1ccc(-c2ccon2)cc1.
What is the InChIKey of oxolane;3-phenyl-1,2-oxazole?
The InChIKey is ZBFZWCWEDCHPPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C4H8O/c1-2-4-8(5-3-1)9-6-7-11-10-9;1-2-4-5-3-1/h1-7H;1-4H2.
What are the key properties of oxolane;3-phenyl-1,2-oxazole?
oxolane;3-phenyl-1,2-oxazole has a molecular weight of 217.27 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;3-phenyl-1,2-oxazole is sourced from PubChem (CID 174347006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).