About 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole
4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole (PubChem CID 174347628) has the molecular formula C19H26N2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole.
Molecular Properties
| Compound Name | 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole |
| PubChem CID | 174347628 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole |
| SMILES | Cc1cc(C)c2[nH]ccc2c1CN1CCC(C2CC2)CC1 |
| InChI | InChI=1S/C19H26N2/c1-13-11-14(2)19-17(5-8-20-19)18(13)12-21-9-6-16(7-10-21)15-3-4-15/h5,8,11,15-16,20H,3-4,6-7,9-10,12H2,1-2H3 |
| InChIKey | KAMGTBCZAIXREL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole?
The IUPAC name of 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole (CID 174347628) is 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole.
What is the SMILES notation for 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole?
The canonical SMILES for 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole is Cc1cc(C)c2[nH]ccc2c1CN1CCC(C2CC2)CC1.
What is the InChIKey of 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole?
The InChIKey is KAMGTBCZAIXREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2/c1-13-11-14(2)19-17(5-8-20-19)18(13)12-21-9-6-16(7-10-21)15-3-4-15/h5,8,11,15-16,20H,3-4,6-7,9-10,12H2,1-2H3.
What are the key properties of 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole?
4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole has a molecular weight of 282.43 g/mol, XLogP of 4.41, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-cyclopropylpiperidin-1-yl)methyl]-5,7-dimethyl-1H-indole is sourced from PubChem (CID 174347628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).