About 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium
1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium (PubChem CID 174347648) has the molecular formula C19H18Ti
and a molecular weight of 294.22 g/mol. Its IUPAC name is 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium.
Molecular Properties
| Compound Name | 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium |
| PubChem CID | 174347648 |
| Molecular Formula | C19H18Ti |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium |
| SMILES | CC1=C(C)C(c2ccccc2-c2ccccc2)=CC1.[Ti] |
| InChI | InChI=1S/C19H18.Ti/c1-14-12-13-17(15(14)2)19-11-7-6-10-18(19)16-8-4-3-5-9-16;/h3-11,13H,12H2,1-2H3; |
| InChIKey | OATHXASCBVPGSA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium?
The IUPAC name of 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium (CID 174347648) is 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium.
What is the SMILES notation for 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium?
The canonical SMILES for 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium is CC1=C(C)C(c2ccccc2-c2ccccc2)=CC1.[Ti].
What is the InChIKey of 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium?
The InChIKey is OATHXASCBVPGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18.Ti/c1-14-12-13-17(15(14)2)19-11-7-6-10-18(19)16-8-4-3-5-9-16;/h3-11,13H,12H2,1-2H3;.
What are the key properties of 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium?
1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium has a molecular weight of 294.22 g/mol, XLogP of 5.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethylcyclopenta-1,4-dien-1-yl)-2-phenylbenzene;titanium is sourced from PubChem (CID 174347648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).