About (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate
(3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate (PubChem CID 174348112) has the molecular formula C21H26I2O3
and a molecular weight of 580.24 g/mol. Its IUPAC name is (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate.
Molecular Properties
| Compound Name | (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate |
| PubChem CID | 174348112 |
| Molecular Formula | C21H26I2O3 |
| Molecular Weight | 580.24 g/mol |
| Exact Mass | 580.00 |
| IUPAC Name | (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate |
| SMILES | C=Cc1cc(I)c(OCC(=O)OC2(CC)CC(CC)C3CC3C2)c(I)c1 |
| InChI | InChI=1S/C21H26I2O3/c1-4-13-7-17(22)20(18(23)8-13)25-12-19(24)26-21(6-3)10-14(5-2)16-9-15(16)11-21/h4,7-8,14-16H,1,5-6,9-12H2,2-3H3 |
| InChIKey | LNIQAXOMHYVVSA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.24 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate?
The IUPAC name of (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate (CID 174348112) is (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate.
What is the SMILES notation for (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate?
The canonical SMILES for (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate is C=Cc1cc(I)c(OCC(=O)OC2(CC)CC(CC)C3CC3C2)c(I)c1.
What is the InChIKey of (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate?
The InChIKey is LNIQAXOMHYVVSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26I2O3/c1-4-13-7-17(22)20(18(23)8-13)25-12-19(24)26-21(6-3)10-14(5-2)16-9-15(16)11-21/h4,7-8,14-16H,1,5-6,9-12H2,2-3H3.
What are the key properties of (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate?
(3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate has a molecular weight of 580.24 g/mol, XLogP of 6.07, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-diethyl-3-bicyclo[4.1.0]heptanyl) 2-(4-ethenyl-2,6-diiodophenoxy)acetate is sourced from PubChem (CID 174348112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).