About 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine
1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine (PubChem CID 174348510) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine.
Molecular Properties
| Compound Name | 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine |
| PubChem CID | 174348510 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine |
| SMILES | CCC1=C([C@@H](C)/C(C)=C(\C)NNC)C1C |
| InChI | InChI=1S/C13H24N2/c1-7-12-10(4)13(12)9(3)8(2)11(5)15-14-6/h9-10,14-15H,7H2,1-6H3/b11-8+/t9-,10?/m0/s1 |
| InChIKey | LXHZZBJNNPEOBM-MKCDUZEASA-N |
| XLogP | 3.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine?
The IUPAC name of 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine (CID 174348510) is 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine.
What is the SMILES notation for 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine?
The canonical SMILES for 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine is CCC1=C([C@@H](C)/C(C)=C(\C)NNC)C1C.
What is the InChIKey of 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine?
The InChIKey is LXHZZBJNNPEOBM-MKCDUZEASA-N. The full InChI is InChI=1S/C13H24N2/c1-7-12-10(4)13(12)9(3)8(2)11(5)15-14-6/h9-10,14-15H,7H2,1-6H3/b11-8+/t9-,10?/m0/s1.
What are the key properties of 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine?
1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine has a molecular weight of 208.35 g/mol, XLogP of 3.00, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E,4R)-4-(2-ethyl-3-methylcyclopropen-1-yl)-3-methylpent-2-en-2-yl]-2-methylhydrazine is sourced from PubChem (CID 174348510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).