C23H43N7 — CID 174348567
(Z)-1-N'-[(E)-2-aminoprop-1-enyl]-4-N'-(methyliminomethyl)-2-[(E,5R)-2-methyl-5-(methylamino)non-1-enyl]-3-propylbut-2-enediimidamide (PubChem CID 174348567) has the molecular formula C23H43N7 and a molecular weight of 417.65 g/mol. Its IUPAC name is (Z)-1-N'-[(E)-2-aminoprop-1-enyl]-4-N'-(methyliminomethyl)-2-[(E,5R)-2-methyl-5-(methylamino)non-1-enyl]-3-propylbut-2-enediimidamide.
| Compound Name | (Z)-1-N'-[(E)-2-aminoprop-1-enyl]-4-N'-(methyliminomethyl)-2-[(E,5R)-2-methyl-5-(methylamino)non-1-enyl]-3-propylbut-2-enediimidamide |
|---|---|
| PubChem CID | 174348567 |
| Molecular Formula | C23H43N7 |
| Molecular Weight | 417.65 g/mol |
| Exact Mass | 417.36 |
| IUPAC Name | (Z)-1-N'-[(E)-2-aminoprop-1-enyl]-4-N'-(methyliminomethyl)-2-[(E,5R)-2-methyl-5-(methylamino)non-1-enyl]-3-propylbut-2-enediimidamide |
| SMILES | CCCC[C@H](CC/C(C)=C/C(/C(N)=N/C=C(\C)N)=C(CCC)/C(N)=N/C=N/C)NC |
| InChI | InChI=1S/C23H43N7/c1-7-9-11-19(28-6)13-12-17(3)14-21(23(26)29-15-18(4)24)20(10-8-2)22(25)30-16-27-5/h14-16,19,28H,7-13,24H2,1-6H3,(H2,26,29)(H2,25,27,30)/b17-14+,18-15+,21-20-/t19-/m1/s1 |
| InChIKey | ZDPDSNLVMSHFOB-QUPZLESNSA-N |
| XLogP | 3.78 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|