C15H12F3N3O3 — CID 17434871
N-methyl-6-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1H-pyridine-3-carboxamide (PubChem CID 17434871) has the molecular formula C15H12F3N3O3 and a molecular weight of 339.27 g/mol. Its IUPAC name is N-methyl-6-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1H-pyridine-3-carboxamide.
| Compound Name | N-methyl-6-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17434871 |
| Molecular Formula | C15H12F3N3O3 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-methyl-6-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1H-pyridine-3-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C15H12F3N3O3/c1-21(15(24)8-2-5-11(22)19-6-8)7-12(23)20-10-4-3-9(16)13(17)14(10)18/h2-6H,7H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | JEKXTALFXYIFIM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|