C9H23O9P3 — CID 174348887
[hydroxy(phosphonooxy)phosphoryl]oxy-(4-methyloctan-4-yl)phosphinic acid (PubChem CID 174348887) has the molecular formula C9H23O9P3 and a molecular weight of 368.20 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl]oxy-(4-methyloctan-4-yl)phosphinic acid.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl]oxy-(4-methyloctan-4-yl)phosphinic acid |
|---|---|
| PubChem CID | 174348887 |
| Molecular Formula | C9H23O9P3 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl]oxy-(4-methyloctan-4-yl)phosphinic acid |
| SMILES | CCCCC(C)(CCC)P(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C9H23O9P3/c1-4-6-8-9(3,7-5-2)19(10,11)17-21(15,16)18-20(12,13)14/h4-8H2,1-3H3,(H,10,11)(H,15,16)(H2,12,13,14) |
| InChIKey | LWSUFXLSJWEJNU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|