C52H36N6 — CID 174349088
2-cyclohexa-1,5-dien-1-yl-4-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-naphthalen-2-ylphenyl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 174349088) has the molecular formula C52H36N6 and a molecular weight of 744.90 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-4-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-naphthalen-2-ylphenyl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-4-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-naphthalen-2-ylphenyl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174349088 |
| Molecular Formula | C52H36N6 |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-4-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-naphthalen-2-ylphenyl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C1=CC(c2nc(-c3ccccc3)nc(-c3ccc(-c4cc(-c5ccc6ccccc6c5)ccc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)n2)=CCC1 |
| InChI | InChI=1S/C52H36N6/c1-5-16-37(17-6-1)47-53-48(38-18-7-2-8-19-38)55-51(54-47)41-28-26-36(27-29-41)46-34-44(43-30-25-35-15-13-14-24-42(35)33-43)31-32-45(46)52-57-49(39-20-9-3-10-21-39)56-50(58-52)40-22-11-4-12-23-40/h1,3-7,9-34H,2,8H2 |
| InChIKey | LJEZZRHHKMCECK-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |