C22H36FN — CID 174349263
(7Z,9Z,11E)-8-fluoro-9-methyl-N-[(Z)-pent-2-en-3-yl]-7-propan-2-yltrideca-7,9,11-trien-3-imine (PubChem CID 174349263) has the molecular formula C22H36FN and a molecular weight of 333.54 g/mol. Its IUPAC name is (7Z,9Z,11E)-8-fluoro-9-methyl-N-[(Z)-pent-2-en-3-yl]-7-propan-2-yltrideca-7,9,11-trien-3-imine.
| Compound Name | (7Z,9Z,11E)-8-fluoro-9-methyl-N-[(Z)-pent-2-en-3-yl]-7-propan-2-yltrideca-7,9,11-trien-3-imine |
|---|---|
| PubChem CID | 174349263 |
| Molecular Formula | C22H36FN |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | (7Z,9Z,11E)-8-fluoro-9-methyl-N-[(Z)-pent-2-en-3-yl]-7-propan-2-yltrideca-7,9,11-trien-3-imine |
| SMILES | C/C=C(CC)\N=C(/CC)CCC/C(=C(F)\C(C)=C/C=C/C)C(C)C |
| InChI | InChI=1S/C22H36FN/c1-8-12-14-18(7)22(23)21(17(5)6)16-13-15-20(11-4)24-19(9-2)10-3/h8-9,12,14,17H,10-11,13,15-16H2,1-7H3/b12-8+,18-14-,19-9-,22-21-,24-20+ |
| InChIKey | PGNPCZWZCNCTDI-SCLXAFGDSA-N |
| XLogP | 7.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|