C20H31N — CID 174349515
N-[2-(6-ethenyl-4-methylcyclohexa-2,4-dien-1-yl)ethyl]-N,2-dimethylhepta-1,6-dien-3-amine (PubChem CID 174349515) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is N-[2-(6-ethenyl-4-methylcyclohexa-2,4-dien-1-yl)ethyl]-N,2-dimethylhepta-1,6-dien-3-amine.
| Compound Name | N-[2-(6-ethenyl-4-methylcyclohexa-2,4-dien-1-yl)ethyl]-N,2-dimethylhepta-1,6-dien-3-amine |
|---|---|
| PubChem CID | 174349515 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-[2-(6-ethenyl-4-methylcyclohexa-2,4-dien-1-yl)ethyl]-N,2-dimethylhepta-1,6-dien-3-amine |
| SMILES | C=CCCC(C(=C)C)N(C)CCC1C=CC(C)=CC1C=C |
| InChI | InChI=1S/C20H31N/c1-7-9-10-20(16(3)4)21(6)14-13-19-12-11-17(5)15-18(19)8-2/h7-8,11-12,15,18-20H,1-3,9-10,13-14H2,4-6H3 |
| InChIKey | UZZNHPIHFAAPMV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|