C46H29N5O — CID 174349574
N-phenyl-9-(4-phenyl-6-triphenylen-2-yl-1,3,5-triazin-2-yl)dibenzofuran-4-carboximidamide (PubChem CID 174349574) has the molecular formula C46H29N5O and a molecular weight of 667.77 g/mol. Its IUPAC name is N-phenyl-9-(4-phenyl-6-triphenylen-2-yl-1,3,5-triazin-2-yl)dibenzofuran-4-carboximidamide.
| Compound Name | N-phenyl-9-(4-phenyl-6-triphenylen-2-yl-1,3,5-triazin-2-yl)dibenzofuran-4-carboximidamide |
|---|---|
| PubChem CID | 174349574 |
| Molecular Formula | C46H29N5O |
| Molecular Weight | 667.77 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | N-phenyl-9-(4-phenyl-6-triphenylen-2-yl-1,3,5-triazin-2-yl)dibenzofuran-4-carboximidamide |
| SMILES | [H]/N=C(\Nc1ccccc1)c1cccc2c1oc1cccc(-c3nc(-c4ccccc4)nc(-c4ccc5c6ccccc6c6ccccc6c5c4)n3)c12 |
| InChI | InChI=1S/C46H29N5O/c47-43(48-30-15-5-2-6-16-30)38-23-11-21-36-41-37(22-12-24-40(41)52-42(36)38)46-50-44(28-13-3-1-4-14-28)49-45(51-46)29-25-26-35-33-19-8-7-17-31(33)32-18-9-10-20-34(32)39(35)27-29/h1-27H,(H2,47,48) |
| InChIKey | WWLZNTKVQKGFLB-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.77 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|