C40H70N8O2 — CID 174350409
2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl octanoate (PubChem CID 174350409) has the molecular formula C40H70N8O2 and a molecular weight of 695.05 g/mol. Its IUPAC name is 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl octanoate.
| Compound Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl octanoate |
|---|---|
| PubChem CID | 174350409 |
| Molecular Formula | C40H70N8O2 |
| Molecular Weight | 695.05 g/mol |
| Exact Mass | 694.56 |
| IUPAC Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl octanoate |
| SMILES | CCCCCCCC(=O)OC1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C40H70N8O2/c1-2-3-4-5-6-22-31(49)50-30-21-13-20-29-32(30)40-47-38-28-19-12-11-18-27(28)36(45-38)43-34-24-15-8-7-14-23(24)33(41-34)42-35-25-16-9-10-17-26(25)37(44-35)46-39(29)48-40/h23-30,32-48H,2-22H2,1H3 |
| InChIKey | RQQFQHNAOUPIHQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.05 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|