C11H18N2 — CID 174351058
4,5-diethyl-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 174351058) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 4,5-diethyl-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | 4,5-diethyl-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 174351058 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4,5-diethyl-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | CCC1CCc2[nH]ncc2C1CC |
| InChI | InChI=1S/C11H18N2/c1-3-8-5-6-11-10(7-12-13-11)9(8)4-2/h7-9H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | ORCKRXFWMJVFIU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |