C23H29N5S — CID 174351284
2-(8-azabicyclo[3.2.1]octan-3-yl)-5-(8-methyl-3,8a-dihydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-propan-2-yl-4H-thieno[3,2-b]pyrrole (PubChem CID 174351284) has the molecular formula C23H29N5S and a molecular weight of 407.59 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-5-(8-methyl-3,8a-dihydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-propan-2-yl-4H-thieno[3,2-b]pyrrole.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-5-(8-methyl-3,8a-dihydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-propan-2-yl-4H-thieno[3,2-b]pyrrole |
|---|---|
| PubChem CID | 174351284 |
| Molecular Formula | C23H29N5S |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-5-(8-methyl-3,8a-dihydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-propan-2-yl-4H-thieno[3,2-b]pyrrole |
| SMILES | CC1=CC(c2[nH]c3cc(C4CC5CCC(C4)N5)sc3c2C(C)C)=CN2NC=NC12 |
| InChI | InChI=1S/C23H29N5S/c1-12(2)20-21(15-6-13(3)23-24-11-25-28(23)10-15)27-18-9-19(29-22(18)20)14-7-16-4-5-17(8-14)26-16/h6,9-12,14,16-17,23,26-27H,4-5,7-8H2,1-3H3,(H,24,25) |
| InChIKey | PGGJEOATGJAPBZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |