C18H23O3P — CID 174351367
[cyclohexa-1,5-dien-1-yl(ethoxy)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 174351367) has the molecular formula C18H23O3P and a molecular weight of 318.35 g/mol. Its IUPAC name is [cyclohexa-1,5-dien-1-yl(ethoxy)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [cyclohexa-1,5-dien-1-yl(ethoxy)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 174351367 |
| Molecular Formula | C18H23O3P |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [cyclohexa-1,5-dien-1-yl(ethoxy)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCOP(=O)(C(=O)c1c(C)cc(C)cc1C)C1=CCCC=C1 |
| InChI | InChI=1S/C18H23O3P/c1-5-21-22(20,16-9-7-6-8-10-16)18(19)17-14(3)11-13(2)12-15(17)4/h7,9-12H,5-6,8H2,1-4H3 |
| InChIKey | NGRPSBICRJYWHF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|